C25H38N4O2 — CID 110875432
1-morpholin-4-yl-4-[(5R,6R,9S,13S)-7-(pyridin-3-ylmethyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butan-1-one (PubChem CID 110875432) has the molecular formula C25H38N4O2 and a molecular weight of 426.61 g/mol. Its IUPAC name is 1-morpholin-4-yl-4-[(5R,6R,9S,13S)-7-(pyridin-3-ylmethyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butan-1-one.
| Compound Name | 1-morpholin-4-yl-4-[(5R,6R,9S,13S)-7-(pyridin-3-ylmethyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butan-1-one |
|---|---|
| PubChem CID | 110875432 |
| Molecular Formula | C25H38N4O2 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | 1-morpholin-4-yl-4-[(5R,6R,9S,13S)-7-(pyridin-3-ylmethyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butan-1-one |
| SMILES | O=C(CCC[C@@H]1[C@H]2CCCN3CCC[C@@H](CN1Cc1cccnc1)[C@@H]23)N1CCOCC1 |
| InChI | InChI=1S/C25H38N4O2/c30-24(27-13-15-31-16-14-27)9-1-8-23-22-7-4-12-28-11-3-6-21(25(22)28)19-29(23)18-20-5-2-10-26-17-20/h2,5,10,17,21-23,25H,1,3-4,6-9,11-16,18-19H2/t21-,22+,23+,25-/m0/s1 |
| InChIKey | TXZLANDDJNMRIL-KBOSCXGNSA-N |
| XLogP | 2.79 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |