C27H36N4O — CID 110875457
4-[(5R,6R,9S,13S)-7-benzyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-pyridin-3-ylbutanamide (PubChem CID 110875457) has the molecular formula C27H36N4O and a molecular weight of 432.61 g/mol. Its IUPAC name is 4-[(5R,6R,9S,13S)-7-benzyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-pyridin-3-ylbutanamide.
| Compound Name | 4-[(5R,6R,9S,13S)-7-benzyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-pyridin-3-ylbutanamide |
|---|---|
| PubChem CID | 110875457 |
| Molecular Formula | C27H36N4O |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | 4-[(5R,6R,9S,13S)-7-benzyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-pyridin-3-ylbutanamide |
| SMILES | O=C(CCC[C@@H]1[C@H]2CCCN3CCC[C@@H](CN1Cc1ccccc1)[C@@H]23)Nc1cccnc1 |
| InChI | InChI=1S/C27H36N4O/c32-26(29-23-11-5-15-28-18-23)14-4-13-25-24-12-7-17-30-16-6-10-22(27(24)30)20-31(25)19-21-8-2-1-3-9-21/h1-3,5,8-9,11,15,18,22,24-25,27H,4,6-7,10,12-14,16-17,19-20H2,(H,29,32)/t22-,24+,25+,27-/m0/s1 |
| InChIKey | WOXATMABMXKATF-TUPPOGIXSA-N |
| XLogP | 4.57 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |