C29H44N4O2 — CID 110195792
4-[(5R,6R,9S,13S)-7-acetyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-(1-benzylpiperidin-4-yl)butanamide (PubChem CID 110195792) has the molecular formula C29H44N4O2 and a molecular weight of 480.70 g/mol. Its IUPAC name is 4-[(5R,6R,9S,13S)-7-acetyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-(1-benzylpiperidin-4-yl)butanamide.
| Compound Name | 4-[(5R,6R,9S,13S)-7-acetyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-(1-benzylpiperidin-4-yl)butanamide |
|---|---|
| PubChem CID | 110195792 |
| Molecular Formula | C29H44N4O2 |
| Molecular Weight | 480.70 g/mol |
| Exact Mass | 480.35 |
| IUPAC Name | 4-[(5R,6R,9S,13S)-7-acetyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-(1-benzylpiperidin-4-yl)butanamide |
| SMILES | CC(=O)N1C[C@@H]2CCCN3CCC[C@@H]([C@H]23)[C@H]1CCCC(=O)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C29H44N4O2/c1-22(34)33-21-24-10-6-16-32-17-7-11-26(29(24)32)27(33)12-5-13-28(35)30-25-14-18-31(19-15-25)20-23-8-3-2-4-9-23/h2-4,8-9,24-27,29H,5-7,10-21H2,1H3,(H,30,35)/t24-,26+,27+,29-/m0/s1 |
| InChIKey | UTQQQUVZBYXNEB-JGOFXRRVSA-N |
| XLogP | 3.66 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.70 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |