C28H37FN4O — CID 110195778
N-[(4-fluorophenyl)methyl]-4-[(5R,6R,9S,13S)-7-(pyridin-3-ylmethyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide (PubChem CID 110195778) has the molecular formula C28H37FN4O and a molecular weight of 464.63 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-4-[(5R,6R,9S,13S)-7-(pyridin-3-ylmethyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-4-[(5R,6R,9S,13S)-7-(pyridin-3-ylmethyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide |
|---|---|
| PubChem CID | 110195778 |
| Molecular Formula | C28H37FN4O |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-4-[(5R,6R,9S,13S)-7-(pyridin-3-ylmethyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide |
| SMILES | O=C(CCC[C@@H]1[C@H]2CCCN3CCC[C@@H](CN1Cc1cccnc1)[C@@H]23)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C28H37FN4O/c29-24-12-10-21(11-13-24)18-31-27(34)9-1-8-26-25-7-4-16-32-15-3-6-23(28(25)32)20-33(26)19-22-5-2-14-30-17-22/h2,5,10-14,17,23,25-26,28H,1,3-4,6-9,15-16,18-20H2,(H,31,34)/t23-,25+,26+,28-/m0/s1 |
| InChIKey | RWCXFAANSQIHQT-DTOIDXSMSA-N |
| XLogP | 4.38 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |