C23H35N3O3S — CID 110194887
N-benzyl-4-[(5S,6R,9S,13S)-7-methylsulfonyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide (PubChem CID 110194887) has the molecular formula C23H35N3O3S and a molecular weight of 433.62 g/mol. Its IUPAC name is N-benzyl-4-[(5S,6R,9S,13S)-7-methylsulfonyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide.
| Compound Name | N-benzyl-4-[(5S,6R,9S,13S)-7-methylsulfonyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide |
|---|---|
| PubChem CID | 110194887 |
| Molecular Formula | C23H35N3O3S |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | N-benzyl-4-[(5S,6R,9S,13S)-7-methylsulfonyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide |
| SMILES | CS(=O)(=O)N1C[C@@H]2CCCN3CCC[C@@H]([C@H]23)[C@H]1CCCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C23H35N3O3S/c1-30(28,29)26-17-19-10-6-14-25-15-7-11-20(23(19)25)21(26)12-5-13-22(27)24-16-18-8-3-2-4-9-18/h2-4,8-9,19-21,23H,5-7,10-17H2,1H3,(H,24,27)/t19-,20+,21+,23-/m0/s1 |
| InChIKey | UXESCDTUKPARAR-GNXKAVGDSA-N |
| XLogP | 2.61 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |