C22H29F3N2O4S — CID 164629147
4-[(5S,6R,9R,13S)-7-[4-(trifluoromethyl)phenyl]sulfonyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid (PubChem CID 164629147) has the molecular formula C22H29F3N2O4S and a molecular weight of 474.55 g/mol. Its IUPAC name is 4-[(5S,6R,9R,13S)-7-[4-(trifluoromethyl)phenyl]sulfonyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid.
| Compound Name | 4-[(5S,6R,9R,13S)-7-[4-(trifluoromethyl)phenyl]sulfonyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid |
|---|---|
| PubChem CID | 164629147 |
| Molecular Formula | C22H29F3N2O4S |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 4-[(5S,6R,9R,13S)-7-[4-(trifluoromethyl)phenyl]sulfonyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoic acid |
| SMILES | O=C(O)CCC[C@@H]1[C@H]2CCCN3CCC[C@H](CN1S(=O)(=O)c1ccc(C(F)(F)F)cc1)[C@@H]23 |
| InChI | InChI=1S/C22H29F3N2O4S/c23-22(24,25)16-8-10-17(11-9-16)32(30,31)27-14-15-4-2-12-26-13-3-5-18(21(15)26)19(27)6-1-7-20(28)29/h8-11,15,18-19,21H,1-7,12-14H2,(H,28,29)/t15-,18-,19-,21+/m1/s1 |
| InChIKey | KIPQYCWXXMQZPD-FEGHXTNJSA-N |
| XLogP | 3.82 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |