C22H27F3N2O4S — CID 71762571
(Z)-4-[(5S,6R,9S,13S)-7-[4-(trifluoromethyl)phenyl]sulfonyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]but-3-enoic acid (PubChem CID 71762571) has the molecular formula C22H27F3N2O4S and a molecular weight of 472.53 g/mol. Its IUPAC name is (Z)-4-[(5S,6R,9S,13S)-7-[4-(trifluoromethyl)phenyl]sulfonyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]but-3-enoic acid.
| Compound Name | (Z)-4-[(5S,6R,9S,13S)-7-[4-(trifluoromethyl)phenyl]sulfonyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]but-3-enoic acid |
|---|---|
| PubChem CID | 71762571 |
| Molecular Formula | C22H27F3N2O4S |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | (Z)-4-[(5S,6R,9S,13S)-7-[4-(trifluoromethyl)phenyl]sulfonyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]but-3-enoic acid |
| SMILES | O=C(O)C/C=C\[C@@H]1[C@H]2CCCN3CCC[C@@H](CN1S(=O)(=O)c1ccc(C(F)(F)F)cc1)[C@@H]23 |
| InChI | InChI=1S/C22H27F3N2O4S/c23-22(24,25)16-8-10-17(11-9-16)32(30,31)27-14-15-4-2-12-26-13-3-5-18(21(15)26)19(27)6-1-7-20(28)29/h1,6,8-11,15,18-19,21H,2-5,7,12-14H2,(H,28,29)/b6-1-/t15-,18+,19+,21-/m0/s1 |
| InChIKey | IFPLDNUNKSYQGL-KXMFFLDDSA-N |
| XLogP | 3.60 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|