C26H26F3N3O6S2 — CID 135125504
[1-[4-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]sulfonylpyrrolidin-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 135125504) has the molecular formula C26H26F3N3O6S2 and a molecular weight of 597.64 g/mol. Its IUPAC name is [1-[4-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]sulfonylpyrrolidin-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [1-[4-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]sulfonylpyrrolidin-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 135125504 |
| Molecular Formula | C26H26F3N3O6S2 |
| Molecular Weight | 597.64 g/mol |
| Exact Mass | 597.12 |
| IUPAC Name | [1-[4-[[4-(trifluoromethyl)phenyl]carbamoylamino]phenyl]sulfonylpyrrolidin-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CCCN2S(=O)(=O)c2ccc(NC(=O)Nc3ccc(C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H26F3N3O6S2/c1-18-4-12-24(13-5-18)40(36,37)38-17-22-3-2-16-32(22)39(34,35)23-14-10-21(11-15-23)31-25(33)30-20-8-6-19(7-9-20)26(27,28)29/h4-15,22H,2-3,16-17H2,1H3,(H2,30,31,33) |
| InChIKey | DBQNRUMELQCHPL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.64 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|