C26H25F3N4O5S — CID 139524558
(2S)-1-[4-[(4-hydroxyphenyl)carbamoylamino]phenyl]sulfonyl-N-[4-(trifluoromethyl)phenyl]piperidine-2-carboxamide (PubChem CID 139524558) has the molecular formula C26H25F3N4O5S and a molecular weight of 562.57 g/mol. Its IUPAC name is (2S)-1-[4-[(4-hydroxyphenyl)carbamoylamino]phenyl]sulfonyl-N-[4-(trifluoromethyl)phenyl]piperidine-2-carboxamide.
| Compound Name | (2S)-1-[4-[(4-hydroxyphenyl)carbamoylamino]phenyl]sulfonyl-N-[4-(trifluoromethyl)phenyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 139524558 |
| Molecular Formula | C26H25F3N4O5S |
| Molecular Weight | 562.57 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | (2S)-1-[4-[(4-hydroxyphenyl)carbamoylamino]phenyl]sulfonyl-N-[4-(trifluoromethyl)phenyl]piperidine-2-carboxamide |
| SMILES | O=C(Nc1ccc(O)cc1)Nc1ccc(S(=O)(=O)N2CCCC[C@H]2C(=O)Nc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C26H25F3N4O5S/c27-26(28,29)17-4-6-18(7-5-17)30-24(35)23-3-1-2-16-33(23)39(37,38)22-14-10-20(11-15-22)32-25(36)31-19-8-12-21(34)13-9-19/h4-15,23,34H,1-3,16H2,(H,30,35)(H2,31,32,36)/t23-/m0/s1 |
| InChIKey | LIGNECLBVHMPME-QHCPKHFHSA-N |
| XLogP | 5.24 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.57 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|