C23H36N2O4S — CID 122185729
4-[(5S,6R,9S,13S)-7-[4-(1-hydroxyethyl)phenyl]sulfonyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butan-1-ol (PubChem CID 122185729) has the molecular formula C23H36N2O4S and a molecular weight of 436.62 g/mol. Its IUPAC name is 4-[(5S,6R,9S,13S)-7-[4-(1-hydroxyethyl)phenyl]sulfonyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butan-1-ol.
| Compound Name | 4-[(5S,6R,9S,13S)-7-[4-(1-hydroxyethyl)phenyl]sulfonyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butan-1-ol |
|---|---|
| PubChem CID | 122185729 |
| Molecular Formula | C23H36N2O4S |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 4-[(5S,6R,9S,13S)-7-[4-(1-hydroxyethyl)phenyl]sulfonyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butan-1-ol |
| SMILES | CC(O)c1ccc(S(=O)(=O)N2C[C@@H]3CCCN4CCC[C@@H]([C@H]34)[C@H]2CCCCO)cc1 |
| InChI | InChI=1S/C23H36N2O4S/c1-17(27)18-9-11-20(12-10-18)30(28,29)25-16-19-6-4-13-24-14-5-7-21(23(19)24)22(25)8-2-3-15-26/h9-12,17,19,21-23,26-27H,2-8,13-16H2,1H3/t17?,19-,21+,22+,23-/m0/s1 |
| InChIKey | ANBXVQIBWMFPMT-KQDUUORCSA-N |
| XLogP | 2.77 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|