C27H35N3O2S — CID 110875408
N-benzyl-4-[(5R,6R,9S,13S)-7-(thiophene-2-carbonyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide (PubChem CID 110875408) has the molecular formula C27H35N3O2S and a molecular weight of 465.66 g/mol. Its IUPAC name is N-benzyl-4-[(5R,6R,9S,13S)-7-(thiophene-2-carbonyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide.
| Compound Name | N-benzyl-4-[(5R,6R,9S,13S)-7-(thiophene-2-carbonyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide |
|---|---|
| PubChem CID | 110875408 |
| Molecular Formula | C27H35N3O2S |
| Molecular Weight | 465.66 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | N-benzyl-4-[(5R,6R,9S,13S)-7-(thiophene-2-carbonyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide |
| SMILES | O=C(CCC[C@@H]1[C@H]2CCCN3CCC[C@@H](CN1C(=O)c1cccs1)[C@@H]23)NCc1ccccc1 |
| InChI | InChI=1S/C27H35N3O2S/c31-25(28-18-20-8-2-1-3-9-20)14-4-12-23-22-11-6-16-29-15-5-10-21(26(22)29)19-30(23)27(32)24-13-7-17-33-24/h1-3,7-9,13,17,21-23,26H,4-6,10-12,14-16,18-19H2,(H,28,31)/t21-,22+,23+,26-/m0/s1 |
| InChIKey | RKIUGBZVKDAYOX-JTKRFKOTSA-N |
| XLogP | 4.55 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.66 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |