C24H42N4O2 — CID 110194858
(5R,6R,9S,13S)-6-[4-(cyclopropylmethylamino)-4-oxobutyl]-N-(2-methylpropyl)-1,7-diazatricyclo[7.3.1.05,13]tridecane-7-carboxamide (PubChem CID 110194858) has the molecular formula C24H42N4O2 and a molecular weight of 418.63 g/mol. Its IUPAC name is (5R,6R,9S,13S)-6-[4-(cyclopropylmethylamino)-4-oxobutyl]-N-(2-methylpropyl)-1,7-diazatricyclo[7.3.1.05,13]tridecane-7-carboxamide.
| Compound Name | (5R,6R,9S,13S)-6-[4-(cyclopropylmethylamino)-4-oxobutyl]-N-(2-methylpropyl)-1,7-diazatricyclo[7.3.1.05,13]tridecane-7-carboxamide |
|---|---|
| PubChem CID | 110194858 |
| Molecular Formula | C24H42N4O2 |
| Molecular Weight | 418.63 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | (5R,6R,9S,13S)-6-[4-(cyclopropylmethylamino)-4-oxobutyl]-N-(2-methylpropyl)-1,7-diazatricyclo[7.3.1.05,13]tridecane-7-carboxamide |
| SMILES | CC(C)CNC(=O)N1C[C@@H]2CCCN3CCC[C@@H]([C@H]23)[C@H]1CCCC(=O)NCC1CC1 |
| InChI | InChI=1S/C24H42N4O2/c1-17(2)14-26-24(30)28-16-19-6-4-12-27-13-5-7-20(23(19)27)21(28)8-3-9-22(29)25-15-18-10-11-18/h17-21,23H,3-16H2,1-2H3,(H,25,29)(H,26,30)/t19-,20+,21+,23-/m0/s1 |
| InChIKey | VPDSOFLDSSCGJL-GNXKAVGDSA-N |
| XLogP | 3.22 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.63 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |