C25H39N5O2 — CID 110194862
N-(cyclopropylmethyl)-4-[(5R,6R,9S,13S)-7-(1-ethylpyrazole-3-carbonyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide (PubChem CID 110194862) has the molecular formula C25H39N5O2 and a molecular weight of 441.62 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-4-[(5R,6R,9S,13S)-7-(1-ethylpyrazole-3-carbonyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide.
| Compound Name | N-(cyclopropylmethyl)-4-[(5R,6R,9S,13S)-7-(1-ethylpyrazole-3-carbonyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide |
|---|---|
| PubChem CID | 110194862 |
| Molecular Formula | C25H39N5O2 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.31 |
| IUPAC Name | N-(cyclopropylmethyl)-4-[(5R,6R,9S,13S)-7-(1-ethylpyrazole-3-carbonyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanamide |
| SMILES | CCn1ccc(C(=O)N2C[C@@H]3CCCN4CCC[C@@H]([C@H]34)[C@H]2CCCC(=O)NCC2CC2)n1 |
| InChI | InChI=1S/C25H39N5O2/c1-2-29-15-12-21(27-29)25(32)30-17-19-6-4-13-28-14-5-7-20(24(19)28)22(30)8-3-9-23(31)26-16-18-10-11-18/h12,15,18-20,22,24H,2-11,13-14,16-17H2,1H3,(H,26,31)/t19-,20+,22+,24-/m0/s1 |
| InChIKey | LGMBUVAUKKYZBA-IKJKNFHUSA-N |
| XLogP | 2.91 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |