C22H35N5O2 — CID 110194907
4-[(5R,6R,9S,13S)-7-(2-ethylpyrazole-3-carbonyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-methylbutanamide (PubChem CID 110194907) has the molecular formula C22H35N5O2 and a molecular weight of 401.56 g/mol. Its IUPAC name is 4-[(5R,6R,9S,13S)-7-(2-ethylpyrazole-3-carbonyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-methylbutanamide.
| Compound Name | 4-[(5R,6R,9S,13S)-7-(2-ethylpyrazole-3-carbonyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-methylbutanamide |
|---|---|
| PubChem CID | 110194907 |
| Molecular Formula | C22H35N5O2 |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.28 |
| IUPAC Name | 4-[(5R,6R,9S,13S)-7-(2-ethylpyrazole-3-carbonyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-methylbutanamide |
| SMILES | CCn1nccc1C(=O)N1C[C@@H]2CCCN3CCC[C@@H]([C@H]23)[C@H]1CCCC(=O)NC |
| InChI | InChI=1S/C22H35N5O2/c1-3-27-19(11-12-24-27)22(29)26-15-16-7-5-13-25-14-6-8-17(21(16)25)18(26)9-4-10-20(28)23-2/h11-12,16-18,21H,3-10,13-15H2,1-2H3,(H,23,28)/t16-,17+,18+,21-/m0/s1 |
| InChIKey | JZZAAJOGLSSYDT-OOSNJVJTSA-N |
| XLogP | 2.13 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |