C20H34N4O4 — CID 110194916
methyl 2-[[(5R,6R,9S,13S)-6-[4-(methylamino)-4-oxobutyl]-1,7-diazatricyclo[7.3.1.05,13]tridecane-7-carbonyl]amino]acetate (PubChem CID 110194916) has the molecular formula C20H34N4O4 and a molecular weight of 394.52 g/mol. Its IUPAC name is methyl 2-[[(5R,6R,9S,13S)-6-[4-(methylamino)-4-oxobutyl]-1,7-diazatricyclo[7.3.1.05,13]tridecane-7-carbonyl]amino]acetate.
| Compound Name | methyl 2-[[(5R,6R,9S,13S)-6-[4-(methylamino)-4-oxobutyl]-1,7-diazatricyclo[7.3.1.05,13]tridecane-7-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 110194916 |
| Molecular Formula | C20H34N4O4 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | methyl 2-[[(5R,6R,9S,13S)-6-[4-(methylamino)-4-oxobutyl]-1,7-diazatricyclo[7.3.1.05,13]tridecane-7-carbonyl]amino]acetate |
| SMILES | CNC(=O)CCC[C@@H]1[C@H]2CCCN3CCC[C@@H](CN1C(=O)NCC(=O)OC)[C@@H]23 |
| InChI | InChI=1S/C20H34N4O4/c1-21-17(25)9-3-8-16-15-7-5-11-23-10-4-6-14(19(15)23)13-24(16)20(27)22-12-18(26)28-2/h14-16,19H,3-13H2,1-2H3,(H,21,25)(H,22,27)/t14-,15+,16+,19-/m0/s1 |
| InChIKey | ARIFSHFGOVZZCA-MKSNKDDYSA-N |
| XLogP | 0.96 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |