C21H36N2O3 — CID 134151440
methyl 4-[(5R,6R,9R,13S)-7-(2,2-dimethylpropanoyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate (PubChem CID 134151440) has the molecular formula C21H36N2O3 and a molecular weight of 364.53 g/mol. Its IUPAC name is methyl 4-[(5R,6R,9R,13S)-7-(2,2-dimethylpropanoyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate.
| Compound Name | methyl 4-[(5R,6R,9R,13S)-7-(2,2-dimethylpropanoyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate |
|---|---|
| PubChem CID | 134151440 |
| Molecular Formula | C21H36N2O3 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.27 |
| IUPAC Name | methyl 4-[(5R,6R,9R,13S)-7-(2,2-dimethylpropanoyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate |
| SMILES | COC(=O)CCC[C@@H]1[C@H]2CCCN3CCC[C@H](CN1C(=O)C(C)(C)C)[C@@H]23 |
| InChI | InChI=1S/C21H36N2O3/c1-21(2,3)20(25)23-14-15-8-6-12-22-13-7-9-16(19(15)22)17(23)10-5-11-18(24)26-4/h15-17,19H,5-14H2,1-4H3/t15-,16-,17-,19+/m1/s1 |
| InChIKey | PRHJIWFTJJOPHR-MTNOOBJLSA-N |
| XLogP | 3.08 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |