C19H32ClN3O3 — CID 134132777
methyl 4-[(5R,6R,9R,13S)-7-(2-chloroethylcarbamoyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate (PubChem CID 134132777) has the molecular formula C19H32ClN3O3 and a molecular weight of 385.94 g/mol. Its IUPAC name is methyl 4-[(5R,6R,9R,13S)-7-(2-chloroethylcarbamoyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate.
| Compound Name | methyl 4-[(5R,6R,9R,13S)-7-(2-chloroethylcarbamoyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate |
|---|---|
| PubChem CID | 134132777 |
| Molecular Formula | C19H32ClN3O3 |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | methyl 4-[(5R,6R,9R,13S)-7-(2-chloroethylcarbamoyl)-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate |
| SMILES | COC(=O)CCC[C@@H]1[C@H]2CCCN3CCC[C@H](CN1C(=O)NCCCl)[C@@H]23 |
| InChI | InChI=1S/C19H32ClN3O3/c1-26-17(24)8-2-7-16-15-6-4-12-22-11-3-5-14(18(15)22)13-23(16)19(25)21-10-9-20/h14-16,18H,2-13H2,1H3,(H,21,25)/t14-,15-,16-,18+/m1/s1 |
| InChIKey | IQDLFLOZPDZUBU-KONPQCLYSA-N |
| XLogP | 2.45 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|