C26H40N2O5 — CID 118716667
methyl 4-[(5R,6R,9R,13S)-7-[(3,4,5-trimethoxyphenyl)methyl]-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate (PubChem CID 118716667) has the molecular formula C26H40N2O5 and a molecular weight of 460.62 g/mol. Its IUPAC name is methyl 4-[(5R,6R,9R,13S)-7-[(3,4,5-trimethoxyphenyl)methyl]-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate.
| Compound Name | methyl 4-[(5R,6R,9R,13S)-7-[(3,4,5-trimethoxyphenyl)methyl]-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate |
|---|---|
| PubChem CID | 118716667 |
| Molecular Formula | C26H40N2O5 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.29 |
| IUPAC Name | methyl 4-[(5R,6R,9R,13S)-7-[(3,4,5-trimethoxyphenyl)methyl]-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butanoate |
| SMILES | COC(=O)CCC[C@@H]1[C@H]2CCCN3CCC[C@H](CN1Cc1cc(OC)c(OC)c(OC)c1)[C@@H]23 |
| InChI | InChI=1S/C26H40N2O5/c1-30-22-14-18(15-23(31-2)26(22)33-4)16-28-17-19-8-6-12-27-13-7-9-20(25(19)27)21(28)10-5-11-24(29)32-3/h14-15,19-21,25H,5-13,16-17H2,1-4H3/t19-,20-,21-,25+/m1/s1 |
| InChIKey | UYWZEAWITSSJOM-YCFYUYSTSA-N |
| XLogP | 3.73 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |