C22H33FN2O — CID 90676707
4-[(5R,6R,9R,13S)-7-[(3-fluorophenyl)methyl]-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butan-1-ol (PubChem CID 90676707) has the molecular formula C22H33FN2O and a molecular weight of 360.52 g/mol. Its IUPAC name is 4-[(5R,6R,9R,13S)-7-[(3-fluorophenyl)methyl]-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butan-1-ol.
| Compound Name | 4-[(5R,6R,9R,13S)-7-[(3-fluorophenyl)methyl]-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butan-1-ol |
|---|---|
| PubChem CID | 90676707 |
| Molecular Formula | C22H33FN2O |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | 4-[(5R,6R,9R,13S)-7-[(3-fluorophenyl)methyl]-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]butan-1-ol |
| SMILES | OCCCC[C@@H]1[C@H]2CCCN3CCC[C@H](CN1Cc1cccc(F)c1)[C@@H]23 |
| InChI | InChI=1S/C22H33FN2O/c23-19-8-3-6-17(14-19)15-25-16-18-7-4-11-24-12-5-9-20(22(18)24)21(25)10-1-2-13-26/h3,6,8,14,18,20-22,26H,1-2,4-5,7,9-13,15-16H2/t18-,20-,21-,22+/m1/s1 |
| InChIKey | ITSRLYKHJPKWRD-NMIHRBCNSA-N |
| XLogP | 3.66 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|