C32H44Cl2N4O — CID 122190991
4-[(5R,6S,9R,13S)-7-benzyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-[4-[bis(2-chloroethyl)amino]phenyl]butanamide (PubChem CID 122190991) has the molecular formula C32H44Cl2N4O and a molecular weight of 571.64 g/mol. Its IUPAC name is 4-[(5R,6S,9R,13S)-7-benzyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-[4-[bis(2-chloroethyl)amino]phenyl]butanamide.
| Compound Name | 4-[(5R,6S,9R,13S)-7-benzyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-[4-[bis(2-chloroethyl)amino]phenyl]butanamide |
|---|---|
| PubChem CID | 122190991 |
| Molecular Formula | C32H44Cl2N4O |
| Molecular Weight | 571.64 g/mol |
| Exact Mass | 570.29 |
| IUPAC Name | 4-[(5R,6S,9R,13S)-7-benzyl-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-[4-[bis(2-chloroethyl)amino]phenyl]butanamide |
| SMILES | O=C(CCC[C@H]1[C@H]2CCCN3CCC[C@H](CN1Cc1ccccc1)[C@@H]23)Nc1ccc(N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C32H44Cl2N4O/c33-17-21-36(22-18-34)28-15-13-27(14-16-28)35-31(39)12-4-11-30-29-10-6-20-37-19-5-9-26(32(29)37)24-38(30)23-25-7-2-1-3-8-25/h1-3,7-8,13-16,26,29-30,32H,4-6,9-12,17-24H2,(H,35,39)/t26-,29-,30+,32+/m1/s1 |
| InChIKey | NNHYCDHMACMQLN-ALXSWLNFSA-N |
| XLogP | 6.45 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.64 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|