C30H40N4O3 — CID 110875400
(5R,6R,9S,13S)-6-(4-anilino-4-oxobutyl)-N-(2-methoxy-5-methylphenyl)-1,7-diazatricyclo[7.3.1.05,13]tridecane-7-carboxamide (PubChem CID 110875400) has the molecular formula C30H40N4O3 and a molecular weight of 504.68 g/mol. Its IUPAC name is (5R,6R,9S,13S)-6-(4-anilino-4-oxobutyl)-N-(2-methoxy-5-methylphenyl)-1,7-diazatricyclo[7.3.1.05,13]tridecane-7-carboxamide.
| Compound Name | (5R,6R,9S,13S)-6-(4-anilino-4-oxobutyl)-N-(2-methoxy-5-methylphenyl)-1,7-diazatricyclo[7.3.1.05,13]tridecane-7-carboxamide |
|---|---|
| PubChem CID | 110875400 |
| Molecular Formula | C30H40N4O3 |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | (5R,6R,9S,13S)-6-(4-anilino-4-oxobutyl)-N-(2-methoxy-5-methylphenyl)-1,7-diazatricyclo[7.3.1.05,13]tridecane-7-carboxamide |
| SMILES | COc1ccc(C)cc1NC(=O)N1C[C@@H]2CCCN3CCC[C@@H]([C@H]23)[C@H]1CCCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C30H40N4O3/c1-21-15-16-27(37-2)25(19-21)32-30(36)34-20-22-9-7-17-33-18-8-12-24(29(22)33)26(34)13-6-14-28(35)31-23-10-4-3-5-11-23/h3-5,10-11,15-16,19,22,24,26,29H,6-9,12-14,17-18,20H2,1-2H3,(H,31,35)(H,32,36)/t22-,24+,26+,29-/m0/s1 |
| InChIKey | JJWOYPGVFPTSMZ-QEFFQVBRSA-N |
| XLogP | 5.52 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |