C32H46ClN3O3 — CID 134145166
4-[(5R,6R,9R,13S)-7-[(4-chlorophenyl)methyl]-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-[(3,4,5-trimethoxyphenyl)methyl]butan-1-amine (PubChem CID 134145166) has the molecular formula C32H46ClN3O3 and a molecular weight of 556.19 g/mol. Its IUPAC name is 4-[(5R,6R,9R,13S)-7-[(4-chlorophenyl)methyl]-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-[(3,4,5-trimethoxyphenyl)methyl]butan-1-amine.
| Compound Name | 4-[(5R,6R,9R,13S)-7-[(4-chlorophenyl)methyl]-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-[(3,4,5-trimethoxyphenyl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 134145166 |
| Molecular Formula | C32H46ClN3O3 |
| Molecular Weight | 556.19 g/mol |
| Exact Mass | 555.32 |
| IUPAC Name | 4-[(5R,6R,9R,13S)-7-[(4-chlorophenyl)methyl]-1,7-diazatricyclo[7.3.1.05,13]tridecan-6-yl]-N-[(3,4,5-trimethoxyphenyl)methyl]butan-1-amine |
| SMILES | COc1cc(CNCCCC[C@@H]2[C@H]3CCCN4CCC[C@H](CN2Cc2ccc(Cl)cc2)[C@@H]34)cc(OC)c1OC |
| InChI | InChI=1S/C32H46ClN3O3/c1-37-29-18-24(19-30(38-2)32(29)39-3)20-34-15-5-4-10-28-27-9-7-17-35-16-6-8-25(31(27)35)22-36(28)21-23-11-13-26(33)14-12-23/h11-14,18-19,25,27-28,31,34H,4-10,15-17,20-22H2,1-3H3/t25-,27-,28-,31+/m1/s1 |
| InChIKey | IISUBEFAWQAYHQ-JBGDWIKQSA-N |
| XLogP | 6.00 |
| TPSA | 46.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.19 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|