C23H28FNO3 — CID 93239109
(3R,3aR,6aS)-1-[(4-fluorophenyl)methyl]-3-(3,4,5-trimethoxyphenyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole (PubChem CID 93239109) has the molecular formula C23H28FNO3 and a molecular weight of 385.48 g/mol. Its IUPAC name is (3R,3aR,6aS)-1-[(4-fluorophenyl)methyl]-3-(3,4,5-trimethoxyphenyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole.
| Compound Name | (3R,3aR,6aS)-1-[(4-fluorophenyl)methyl]-3-(3,4,5-trimethoxyphenyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole |
|---|---|
| PubChem CID | 93239109 |
| Molecular Formula | C23H28FNO3 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | (3R,3aR,6aS)-1-[(4-fluorophenyl)methyl]-3-(3,4,5-trimethoxyphenyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole |
| SMILES | COc1cc([C@@H]2CN(Cc3ccc(F)cc3)[C@H]3CCC[C@H]23)cc(OC)c1OC |
| InChI | InChI=1S/C23H28FNO3/c1-26-21-11-16(12-22(27-2)23(21)28-3)19-14-25(20-6-4-5-18(19)20)13-15-7-9-17(24)10-8-15/h7-12,18-20H,4-6,13-14H2,1-3H3/t18-,19+,20+/m1/s1 |
| InChIKey | XPFKCAOXTKOTDL-AABGKKOBSA-N |
| XLogP | 4.62 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |