C19H30N4O2 — CID 154795042
N',N'-diethyl-N-[1-(pyridin-3-ylmethyl)piperidin-4-yl]butanediamide (PubChem CID 154795042) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is N',N'-diethyl-N-[1-(pyridin-3-ylmethyl)piperidin-4-yl]butanediamide.
| Compound Name | N',N'-diethyl-N-[1-(pyridin-3-ylmethyl)piperidin-4-yl]butanediamide |
|---|---|
| PubChem CID | 154795042 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | N',N'-diethyl-N-[1-(pyridin-3-ylmethyl)piperidin-4-yl]butanediamide |
| SMILES | CCN(CC)C(=O)CCC(=O)NC1CCN(Cc2cccnc2)CC1 |
| InChI | InChI=1S/C19H30N4O2/c1-3-23(4-2)19(25)8-7-18(24)21-17-9-12-22(13-10-17)15-16-6-5-11-20-14-16/h5-6,11,14,17H,3-4,7-10,12-13,15H2,1-2H3,(H,21,24) |
| InChIKey | TUVOEZSLXZJIEJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |