C17H24N2O5 — CID 110198236
(2S,4S)-1-[2-(2-methoxyethoxy)acetyl]-N-methyl-4-phenoxypyrrolidine-2-carboxamide (PubChem CID 110198236) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is (2S,4S)-1-[2-(2-methoxyethoxy)acetyl]-N-methyl-4-phenoxypyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-1-[2-(2-methoxyethoxy)acetyl]-N-methyl-4-phenoxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110198236 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | (2S,4S)-1-[2-(2-methoxyethoxy)acetyl]-N-methyl-4-phenoxypyrrolidine-2-carboxamide |
| SMILES | CNC(=O)[C@@H]1C[C@H](Oc2ccccc2)CN1C(=O)COCCOC |
| InChI | InChI=1S/C17H24N2O5/c1-18-17(21)15-10-14(24-13-6-4-3-5-7-13)11-19(15)16(20)12-23-9-8-22-2/h3-7,14-15H,8-12H2,1-2H3,(H,18,21)/t14-,15-/m0/s1 |
| InChIKey | CQBOCSKFIWHYLX-GJZGRUSLSA-N |
| XLogP | 0.44 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|