C17H25N3O4 — CID 110198415
(2S,4S)-1-N-ethyl-2-N-(2-methoxyethyl)-4-phenoxypyrrolidine-1,2-dicarboxamide (PubChem CID 110198415) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is (2S,4S)-1-N-ethyl-2-N-(2-methoxyethyl)-4-phenoxypyrrolidine-1,2-dicarboxamide.
| Compound Name | (2S,4S)-1-N-ethyl-2-N-(2-methoxyethyl)-4-phenoxypyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 110198415 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | (2S,4S)-1-N-ethyl-2-N-(2-methoxyethyl)-4-phenoxypyrrolidine-1,2-dicarboxamide |
| SMILES | CCNC(=O)N1C[C@@H](Oc2ccccc2)C[C@H]1C(=O)NCCOC |
| InChI | InChI=1S/C17H25N3O4/c1-3-18-17(22)20-12-14(24-13-7-5-4-6-8-13)11-15(20)16(21)19-9-10-23-2/h4-8,14-15H,3,9-12H2,1-2H3,(H,18,22)(H,19,21)/t14-,15-/m0/s1 |
| InChIKey | MHMBBMUTRYPYAT-GJZGRUSLSA-N |
| XLogP | 1.00 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|