C23H27N3O6 — CID 110196943
(2R,4S)-1-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-N-(2-methoxyethyl)-4-phenoxypyrrolidine-1,2-dicarboxamide (PubChem CID 110196943) has the molecular formula C23H27N3O6 and a molecular weight of 441.48 g/mol. Its IUPAC name is (2R,4S)-1-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-N-(2-methoxyethyl)-4-phenoxypyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R,4S)-1-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-N-(2-methoxyethyl)-4-phenoxypyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 110196943 |
| Molecular Formula | C23H27N3O6 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | (2R,4S)-1-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-N-(2-methoxyethyl)-4-phenoxypyrrolidine-1,2-dicarboxamide |
| SMILES | COCCNC(=O)[C@H]1C[C@H](Oc2ccccc2)CN1C(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C23H27N3O6/c1-29-10-9-24-22(27)19-14-18(32-17-5-3-2-4-6-17)15-26(19)23(28)25-16-7-8-20-21(13-16)31-12-11-30-20/h2-8,13,18-19H,9-12,14-15H2,1H3,(H,24,27)(H,25,28)/t18-,19+/m0/s1 |
| InChIKey | UXLLBDQFUBQZPC-RBUKOAKNSA-N |
| XLogP | 2.27 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|