C20H24N4O4 — CID 110197058
(2R,4S)-2-N-(2-methoxyethyl)-1-N-phenyl-4-pyridin-3-yloxypyrrolidine-1,2-dicarboxamide (PubChem CID 110197058) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is (2R,4S)-2-N-(2-methoxyethyl)-1-N-phenyl-4-pyridin-3-yloxypyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R,4S)-2-N-(2-methoxyethyl)-1-N-phenyl-4-pyridin-3-yloxypyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 110197058 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (2R,4S)-2-N-(2-methoxyethyl)-1-N-phenyl-4-pyridin-3-yloxypyrrolidine-1,2-dicarboxamide |
| SMILES | COCCNC(=O)[C@H]1C[C@H](Oc2cccnc2)CN1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H24N4O4/c1-27-11-10-22-19(25)18-12-17(28-16-8-5-9-21-13-16)14-24(18)20(26)23-15-6-3-2-4-7-15/h2-9,13,17-18H,10-12,14H2,1H3,(H,22,25)(H,23,26)/t17-,18+/m0/s1 |
| InChIKey | ONMJKAQHPCJJJU-ZWKOTPCHSA-N |
| XLogP | 1.90 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|