C20H29N3O4 — CID 110198800
(2S,4S)-1-(cyclohexanecarbonyl)-N-(2-methoxyethyl)-4-pyridin-3-yloxypyrrolidine-2-carboxamide (PubChem CID 110198800) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is (2S,4S)-1-(cyclohexanecarbonyl)-N-(2-methoxyethyl)-4-pyridin-3-yloxypyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-1-(cyclohexanecarbonyl)-N-(2-methoxyethyl)-4-pyridin-3-yloxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110198800 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | (2S,4S)-1-(cyclohexanecarbonyl)-N-(2-methoxyethyl)-4-pyridin-3-yloxypyrrolidine-2-carboxamide |
| SMILES | COCCNC(=O)[C@@H]1C[C@H](Oc2cccnc2)CN1C(=O)C1CCCCC1 |
| InChI | InChI=1S/C20H29N3O4/c1-26-11-10-22-19(24)18-12-17(27-16-8-5-9-21-13-16)14-23(18)20(25)15-6-3-2-4-7-15/h5,8-9,13,15,17-18H,2-4,6-7,10-12,14H2,1H3,(H,22,24)/t17-,18-/m0/s1 |
| InChIKey | NHPWOFKRJOEGSC-ROUUACIJSA-N |
| XLogP | 1.77 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|