C19H24N4O4 — CID 110198401
(2S,4S)-N-(2-methoxyethyl)-1-(2-methylpyrazole-3-carbonyl)-4-phenoxypyrrolidine-2-carboxamide (PubChem CID 110198401) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is (2S,4S)-N-(2-methoxyethyl)-1-(2-methylpyrazole-3-carbonyl)-4-phenoxypyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-N-(2-methoxyethyl)-1-(2-methylpyrazole-3-carbonyl)-4-phenoxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110198401 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | (2S,4S)-N-(2-methoxyethyl)-1-(2-methylpyrazole-3-carbonyl)-4-phenoxypyrrolidine-2-carboxamide |
| SMILES | COCCNC(=O)[C@@H]1C[C@H](Oc2ccccc2)CN1C(=O)c1ccnn1C |
| InChI | InChI=1S/C19H24N4O4/c1-22-16(8-9-21-22)19(25)23-13-15(27-14-6-4-3-5-7-14)12-17(23)18(24)20-10-11-26-2/h3-9,15,17H,10-13H2,1-2H3,(H,20,24)/t15-,17-/m0/s1 |
| InChIKey | YQXOPLJQEGXBJM-RDJZCZTQSA-N |
| XLogP | 0.84 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|