C18H21N3O4S — CID 110197069
(2R,4S)-N-(2-methoxyethyl)-4-pyridin-3-yloxy-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 110197069) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is (2R,4S)-N-(2-methoxyethyl)-4-pyridin-3-yloxy-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R,4S)-N-(2-methoxyethyl)-4-pyridin-3-yloxy-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110197069 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | (2R,4S)-N-(2-methoxyethyl)-4-pyridin-3-yloxy-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | COCCNC(=O)[C@H]1C[C@H](Oc2cccnc2)CN1C(=O)c1cccs1 |
| InChI | InChI=1S/C18H21N3O4S/c1-24-8-7-20-17(22)15-10-14(25-13-4-2-6-19-11-13)12-21(15)18(23)16-5-3-9-26-16/h2-6,9,11,14-15H,7-8,10,12H2,1H3,(H,20,22)/t14-,15+/m0/s1 |
| InChIKey | ZPNXWWLBTXZGPP-LSDHHAIUSA-N |
| XLogP | 1.57 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|