C20H23FN2O5S — CID 110196927
(2R,4S)-1-(4-fluorophenyl)sulfonyl-N-(2-methoxyethyl)-4-phenoxypyrrolidine-2-carboxamide (PubChem CID 110196927) has the molecular formula C20H23FN2O5S and a molecular weight of 422.48 g/mol. Its IUPAC name is (2R,4S)-1-(4-fluorophenyl)sulfonyl-N-(2-methoxyethyl)-4-phenoxypyrrolidine-2-carboxamide.
| Compound Name | (2R,4S)-1-(4-fluorophenyl)sulfonyl-N-(2-methoxyethyl)-4-phenoxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110196927 |
| Molecular Formula | C20H23FN2O5S |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | (2R,4S)-1-(4-fluorophenyl)sulfonyl-N-(2-methoxyethyl)-4-phenoxypyrrolidine-2-carboxamide |
| SMILES | COCCNC(=O)[C@H]1C[C@H](Oc2ccccc2)CN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H23FN2O5S/c1-27-12-11-22-20(24)19-13-17(28-16-5-3-2-4-6-16)14-23(19)29(25,26)18-9-7-15(21)8-10-18/h2-10,17,19H,11-14H2,1H3,(H,22,24)/t17-,19+/m0/s1 |
| InChIKey | ZTFWIZVVCXFQSU-PKOBYXMFSA-N |
| XLogP | 1.80 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|