C22H27FN4O5S — CID 134084984
4-(4-fluorophenyl)sulfonyl-3-N-(2-methoxyethyl)-1-N-(4-methylphenyl)piperazine-1,3-dicarboxamide (PubChem CID 134084984) has the molecular formula C22H27FN4O5S and a molecular weight of 478.55 g/mol. Its IUPAC name is 4-(4-fluorophenyl)sulfonyl-3-N-(2-methoxyethyl)-1-N-(4-methylphenyl)piperazine-1,3-dicarboxamide.
| Compound Name | 4-(4-fluorophenyl)sulfonyl-3-N-(2-methoxyethyl)-1-N-(4-methylphenyl)piperazine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 134084984 |
| Molecular Formula | C22H27FN4O5S |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 4-(4-fluorophenyl)sulfonyl-3-N-(2-methoxyethyl)-1-N-(4-methylphenyl)piperazine-1,3-dicarboxamide |
| SMILES | COCCNC(=O)C1CN(C(=O)Nc2ccc(C)cc2)CCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H27FN4O5S/c1-16-3-7-18(8-4-16)25-22(29)26-12-13-27(20(15-26)21(28)24-11-14-32-2)33(30,31)19-9-5-17(23)6-10-19/h3-10,20H,11-15H2,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | AMEQMHAWZMHTSP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|