C22H30N2O3 — CID 110198582
(2S,4S)-1-(2-cyclohexylacetyl)-N-cyclopropyl-4-phenoxypyrrolidine-2-carboxamide (PubChem CID 110198582) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is (2S,4S)-1-(2-cyclohexylacetyl)-N-cyclopropyl-4-phenoxypyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-1-(2-cyclohexylacetyl)-N-cyclopropyl-4-phenoxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110198582 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | (2S,4S)-1-(2-cyclohexylacetyl)-N-cyclopropyl-4-phenoxypyrrolidine-2-carboxamide |
| SMILES | O=C(NC1CC1)[C@@H]1C[C@H](Oc2ccccc2)CN1C(=O)CC1CCCCC1 |
| InChI | InChI=1S/C22H30N2O3/c25-21(13-16-7-3-1-4-8-16)24-15-19(27-18-9-5-2-6-10-18)14-20(24)22(26)23-17-11-12-17/h2,5-6,9-10,16-17,19-20H,1,3-4,7-8,11-15H2,(H,23,26)/t19-,20-/m0/s1 |
| InChIKey | UNTZXPGCOSFAQX-PMACEKPBSA-N |
| XLogP | 3.28 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |