C24H39N5O2 — CID 110199556
4-oxo-N-(3-piperidin-1-ylpropyl)-1-(pyridin-4-ylmethyl)-1,5-diazacycloundecane-8-carboxamide (PubChem CID 110199556) has the molecular formula C24H39N5O2 and a molecular weight of 429.61 g/mol. Its IUPAC name is 4-oxo-N-(3-piperidin-1-ylpropyl)-1-(pyridin-4-ylmethyl)-1,5-diazacycloundecane-8-carboxamide.
| Compound Name | 4-oxo-N-(3-piperidin-1-ylpropyl)-1-(pyridin-4-ylmethyl)-1,5-diazacycloundecane-8-carboxamide |
|---|---|
| PubChem CID | 110199556 |
| Molecular Formula | C24H39N5O2 |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.31 |
| IUPAC Name | 4-oxo-N-(3-piperidin-1-ylpropyl)-1-(pyridin-4-ylmethyl)-1,5-diazacycloundecane-8-carboxamide |
| SMILES | O=C1CCN(Cc2ccncc2)CCCC(C(=O)NCCCN2CCCCC2)CCN1 |
| InChI | InChI=1S/C24H39N5O2/c30-23-10-19-29(20-21-7-12-25-13-8-21)17-4-6-22(9-14-26-23)24(31)27-11-5-18-28-15-2-1-3-16-28/h7-8,12-13,22H,1-6,9-11,14-20H2,(H,26,30)(H,27,31) |
| InChIKey | HYNRAQTUBVGVOY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|