C23H37N5O3 — CID 110199564
N-(3-morpholin-4-ylpropyl)-4-oxo-1-(pyridin-3-ylmethyl)-1,5-diazacycloundecane-8-carboxamide (PubChem CID 110199564) has the molecular formula C23H37N5O3 and a molecular weight of 431.58 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-4-oxo-1-(pyridin-3-ylmethyl)-1,5-diazacycloundecane-8-carboxamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-4-oxo-1-(pyridin-3-ylmethyl)-1,5-diazacycloundecane-8-carboxamide |
|---|---|
| PubChem CID | 110199564 |
| Molecular Formula | C23H37N5O3 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.29 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-4-oxo-1-(pyridin-3-ylmethyl)-1,5-diazacycloundecane-8-carboxamide |
| SMILES | O=C1CCN(Cc2cccnc2)CCCC(C(=O)NCCCN2CCOCC2)CCN1 |
| InChI | InChI=1S/C23H37N5O3/c29-22-7-13-28(19-20-4-1-8-24-18-20)11-2-5-21(6-10-25-22)23(30)26-9-3-12-27-14-16-31-17-15-27/h1,4,8,18,21H,2-3,5-7,9-17,19H2,(H,25,29)(H,26,30) |
| InChIKey | SEFUBDCFUNQCIH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|