C24H36N4O3 — CID 110201146
N-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-7-hydroxy-1-(2-methoxyethyl)-N-methyl-2,3,4,5,6,7-hexahydro-1-benzazonine-9-carboxamide (PubChem CID 110201146) has the molecular formula C24H36N4O3 and a molecular weight of 428.58 g/mol. Its IUPAC name is N-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-7-hydroxy-1-(2-methoxyethyl)-N-methyl-2,3,4,5,6,7-hexahydro-1-benzazonine-9-carboxamide.
| Compound Name | N-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-7-hydroxy-1-(2-methoxyethyl)-N-methyl-2,3,4,5,6,7-hexahydro-1-benzazonine-9-carboxamide |
|---|---|
| PubChem CID | 110201146 |
| Molecular Formula | C24H36N4O3 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | N-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-7-hydroxy-1-(2-methoxyethyl)-N-methyl-2,3,4,5,6,7-hexahydro-1-benzazonine-9-carboxamide |
| SMILES | CCn1cc(CN(C)C(=O)c2ccc3c(c2)C(O)CCCCCN3CCOC)c(C)n1 |
| InChI | InChI=1S/C24H36N4O3/c1-5-28-17-20(18(2)25-28)16-26(3)24(30)19-10-11-22-21(15-19)23(29)9-7-6-8-12-27(22)13-14-31-4/h10-11,15,17,23,29H,5-9,12-14,16H2,1-4H3 |
| InChIKey | VDIVDECBLHWJHJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |