C23H30N2O2 — CID 110201053
7-hydroxy-1-methyl-N-(3-phenylpropyl)-2,3,4,5,6,7-hexahydro-1-benzazonine-9-carboxamide (PubChem CID 110201053) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 7-hydroxy-1-methyl-N-(3-phenylpropyl)-2,3,4,5,6,7-hexahydro-1-benzazonine-9-carboxamide.
| Compound Name | 7-hydroxy-1-methyl-N-(3-phenylpropyl)-2,3,4,5,6,7-hexahydro-1-benzazonine-9-carboxamide |
|---|---|
| PubChem CID | 110201053 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 7-hydroxy-1-methyl-N-(3-phenylpropyl)-2,3,4,5,6,7-hexahydro-1-benzazonine-9-carboxamide |
| SMILES | CN1CCCCCC(O)c2cc(C(=O)NCCCc3ccccc3)ccc21 |
| InChI | InChI=1S/C23H30N2O2/c1-25-16-7-3-6-12-22(26)20-17-19(13-14-21(20)25)23(27)24-15-8-11-18-9-4-2-5-10-18/h2,4-5,9-10,13-14,17,22,26H,3,6-8,11-12,15-16H2,1H3,(H,24,27) |
| InChIKey | KLDHMUKNKQPAQK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|