C25H31N3O3 — CID 110201072
7-hydroxy-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-1-methyl-2,3,4,5,6,7-hexahydro-1-benzazonine-9-carboxamide (PubChem CID 110201072) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is 7-hydroxy-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-1-methyl-2,3,4,5,6,7-hexahydro-1-benzazonine-9-carboxamide.
| Compound Name | 7-hydroxy-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-1-methyl-2,3,4,5,6,7-hexahydro-1-benzazonine-9-carboxamide |
|---|---|
| PubChem CID | 110201072 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 7-hydroxy-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-1-methyl-2,3,4,5,6,7-hexahydro-1-benzazonine-9-carboxamide |
| SMILES | COc1ccc2[nH]cc(CCNC(=O)c3ccc4c(c3)C(O)CCCCCN4C)c2c1 |
| InChI | InChI=1S/C25H31N3O3/c1-28-13-5-3-4-6-24(29)21-14-17(7-10-23(21)28)25(30)26-12-11-18-16-27-22-9-8-19(31-2)15-20(18)22/h7-10,14-16,24,27,29H,3-6,11-13H2,1-2H3,(H,26,30) |
| InChIKey | SMUKHYITZHEIMW-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |