C28H27N3O3 — CID 53010729
4-(1-acetyl-2,3-dihydroindol-5-yl)-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]benzamide (PubChem CID 53010729) has the molecular formula C28H27N3O3 and a molecular weight of 453.54 g/mol. Its IUPAC name is 4-(1-acetyl-2,3-dihydroindol-5-yl)-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]benzamide.
| Compound Name | 4-(1-acetyl-2,3-dihydroindol-5-yl)-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 53010729 |
| Molecular Formula | C28H27N3O3 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 4-(1-acetyl-2,3-dihydroindol-5-yl)-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]benzamide |
| SMILES | COc1ccc2[nH]cc(CCNC(=O)c3ccc(-c4ccc5c(c4)CCN5C(C)=O)cc3)c2c1 |
| InChI | InChI=1S/C28H27N3O3/c1-18(32)31-14-12-22-15-21(7-10-27(22)31)19-3-5-20(6-4-19)28(33)29-13-11-23-17-30-26-9-8-24(34-2)16-25(23)26/h3-10,15-17,30H,11-14H2,1-2H3,(H,29,33) |
| InChIKey | JEWLTFIXBJENDT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |