C28H35N3O2S — CID 93153288
2-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylsulfanyl]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]benzamide (PubChem CID 93153288) has the molecular formula C28H35N3O2S and a molecular weight of 477.67 g/mol. Its IUPAC name is 2-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylsulfanyl]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]benzamide.
| Compound Name | 2-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylsulfanyl]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 93153288 |
| Molecular Formula | C28H35N3O2S |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 2-[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylsulfanyl]-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]benzamide |
| SMILES | COc1ccc2[nH]cc(CCNC(=O)c3ccccc3SC[C@H]3CCCN4CCCC[C@H]34)c2c1 |
| InChI | InChI=1S/C28H35N3O2S/c1-33-22-11-12-25-24(17-22)20(18-30-25)13-14-29-28(32)23-8-2-3-10-27(23)34-19-21-7-6-16-31-15-5-4-9-26(21)31/h2-3,8,10-12,17-18,21,26,30H,4-7,9,13-16,19H2,1H3,(H,29,32)/t21-,26-/m1/s1 |
| InChIKey | GJAYETZNERUDBM-QFQXNSOFSA-N |
| XLogP | 5.51 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |