C10H14O5 — CID 11020245
(1S,3aS,6R,6aS)-6-(methoxymethoxy)-3-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-1-carbaldehyde (PubChem CID 11020245) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is (1S,3aS,6R,6aS)-6-(methoxymethoxy)-3-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-1-carbaldehyde.
| Compound Name | (1S,3aS,6R,6aS)-6-(methoxymethoxy)-3-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-1-carbaldehyde |
|---|---|
| PubChem CID | 11020245 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (1S,3aS,6R,6aS)-6-(methoxymethoxy)-3-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[c]furan-1-carbaldehyde |
| SMILES | COCO[C@@H]1CC[C@@H]2C(=O)O[C@H](C=O)[C@@H]21 |
| InChI | InChI=1S/C10H14O5/c1-13-5-14-7-3-2-6-9(7)8(4-11)15-10(6)12/h4,6-9H,2-3,5H2,1H3/t6-,7+,8+,9-/m0/s1 |
| InChIKey | AEUZGSFHOOHIDU-KDXUFGMBSA-N |
| XLogP | 0.13 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|