C10H20O3Si — CID 11020315
methyl (E,3R)-3-trimethylsilyloxyhex-4-enoate (PubChem CID 11020315) has the molecular formula C10H20O3Si and a molecular weight of 216.35 g/mol. Its IUPAC name is methyl (E,3R)-3-trimethylsilyloxyhex-4-enoate.
| Compound Name | methyl (E,3R)-3-trimethylsilyloxyhex-4-enoate |
|---|---|
| PubChem CID | 11020315 |
| Molecular Formula | C10H20O3Si |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | methyl (E,3R)-3-trimethylsilyloxyhex-4-enoate |
| SMILES | C/C=C/[C@@H](CC(=O)OC)O[Si](C)(C)C |
| InChI | InChI=1S/C10H20O3Si/c1-6-7-9(8-10(11)12-2)13-14(3,4)5/h6-7,9H,8H2,1-5H3/b7-6+/t9-/m0/s1 |
| InChIKey | ORSKSVKSHDFNCZ-UCUJLANTSA-N |
| XLogP | 2.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|