C13H11N3S — CID 110205617
7-(4-methylsulfanylphenyl)pyrazolo[1,5-a]pyrimidine (PubChem CID 110205617) has the molecular formula C13H11N3S and a molecular weight of 241.32 g/mol. Its IUPAC name is 7-(4-methylsulfanylphenyl)pyrazolo[1,5-a]pyrimidine.
| Compound Name | 7-(4-methylsulfanylphenyl)pyrazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 110205617 |
| Molecular Formula | C13H11N3S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 7-(4-methylsulfanylphenyl)pyrazolo[1,5-a]pyrimidine |
| SMILES | CSc1ccc(-c2ccnc3ccnn23)cc1 |
| InChI | InChI=1S/C13H11N3S/c1-17-11-4-2-10(3-5-11)12-6-8-14-13-7-9-15-16(12)13/h2-9H,1H3 |
| InChIKey | DXYAJWIKEWJFIB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |