C23H22N6O3 — CID 110207138
6-(5,11-dioxo-6aH-isoindolo[2,1-a]quinazolin-6-yl)-N-(1H-1,2,4-triazol-5-yl)hexanamide (PubChem CID 110207138) has the molecular formula C23H22N6O3 and a molecular weight of 430.47 g/mol. Its IUPAC name is 6-(5,11-dioxo-6aH-isoindolo[2,1-a]quinazolin-6-yl)-N-(1H-1,2,4-triazol-5-yl)hexanamide.
| Compound Name | 6-(5,11-dioxo-6aH-isoindolo[2,1-a]quinazolin-6-yl)-N-(1H-1,2,4-triazol-5-yl)hexanamide |
|---|---|
| PubChem CID | 110207138 |
| Molecular Formula | C23H22N6O3 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 6-(5,11-dioxo-6aH-isoindolo[2,1-a]quinazolin-6-yl)-N-(1H-1,2,4-triazol-5-yl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)c2ccccc2N2C(=O)c3ccccc3C12)Nc1ncn[nH]1 |
| InChI | InChI=1S/C23H22N6O3/c30-19(26-23-24-14-25-27-23)12-2-1-7-13-28-20-15-8-3-4-9-16(15)22(32)29(20)18-11-6-5-10-17(18)21(28)31/h3-6,8-11,14,20H,1-2,7,12-13H2,(H2,24,25,26,27,30) |
| InChIKey | GZXXOSKVAKUQKS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|