C27H24ClN3O4 — CID 110207880
N-(5-chloro-2-hydroxyphenyl)-6-(5,11-dioxo-6aH-isoindolo[2,1-a]quinazolin-6-yl)hexanamide (PubChem CID 110207880) has the molecular formula C27H24ClN3O4 and a molecular weight of 489.96 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-6-(5,11-dioxo-6aH-isoindolo[2,1-a]quinazolin-6-yl)hexanamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-6-(5,11-dioxo-6aH-isoindolo[2,1-a]quinazolin-6-yl)hexanamide |
|---|---|
| PubChem CID | 110207880 |
| Molecular Formula | C27H24ClN3O4 |
| Molecular Weight | 489.96 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-6-(5,11-dioxo-6aH-isoindolo[2,1-a]quinazolin-6-yl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)c2ccccc2N2C(=O)c3ccccc3C12)Nc1cc(Cl)ccc1O |
| InChI | InChI=1S/C27H24ClN3O4/c28-17-13-14-23(32)21(16-17)29-24(33)12-2-1-7-15-30-25-18-8-3-4-9-19(18)27(35)31(25)22-11-6-5-10-20(22)26(30)34/h3-6,8-11,13-14,16,25,32H,1-2,7,12,15H2,(H,29,33) |
| InChIKey | CKZDXKFANQWYCF-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.96 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|