C14H20O3 — CID 11020879
(5R,8S)-8-but-3-enyl-9,9-dimethyl-2-oxaspiro[4.4]nonane-1,7-dione (PubChem CID 11020879) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (5R,8S)-8-but-3-enyl-9,9-dimethyl-2-oxaspiro[4.4]nonane-1,7-dione.
| Compound Name | (5R,8S)-8-but-3-enyl-9,9-dimethyl-2-oxaspiro[4.4]nonane-1,7-dione |
|---|---|
| PubChem CID | 11020879 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (5R,8S)-8-but-3-enyl-9,9-dimethyl-2-oxaspiro[4.4]nonane-1,7-dione |
| SMILES | C=CCC[C@@H]1C(=O)C[C@]2(CCOC2=O)C1(C)C |
| InChI | InChI=1S/C14H20O3/c1-4-5-6-10-11(15)9-14(13(10,2)3)7-8-17-12(14)16/h4,10H,1,5-9H2,2-3H3/t10-,14+/m1/s1 |
| InChIKey | LGDLCMVMUZNYGN-YGRLFVJLSA-N |
| XLogP | 2.50 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|