C21H24N2O3 — CID 110209124
1-(3,4-dihydroxyphenyl)-2-[4-(3-phenylprop-2-enyl)piperazin-1-yl]ethanone (PubChem CID 110209124) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-2-[4-(3-phenylprop-2-enyl)piperazin-1-yl]ethanone.
| Compound Name | 1-(3,4-dihydroxyphenyl)-2-[4-(3-phenylprop-2-enyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 110209124 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-2-[4-(3-phenylprop-2-enyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CN1CCN(CC=Cc2ccccc2)CC1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C21H24N2O3/c24-19-9-8-18(15-20(19)25)21(26)16-23-13-11-22(12-14-23)10-4-7-17-5-2-1-3-6-17/h1-9,15,24-25H,10-14,16H2 |
| InChIKey | LPAHPBSFMREBAD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|