C16H24N4OS — CID 110209472
N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-2-(2,2-dimethylcyclohexylidene)acetamide (PubChem CID 110209472) has the molecular formula C16H24N4OS and a molecular weight of 320.46 g/mol. Its IUPAC name is N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-2-(2,2-dimethylcyclohexylidene)acetamide.
| Compound Name | N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-2-(2,2-dimethylcyclohexylidene)acetamide |
|---|---|
| PubChem CID | 110209472 |
| Molecular Formula | C16H24N4OS |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-2-(2,2-dimethylcyclohexylidene)acetamide |
| SMILES | CC1(C)CCCCC1=CC(=O)NCc1n[nH]c(=S)n1C1CC1 |
| InChI | InChI=1S/C16H24N4OS/c1-16(2)8-4-3-5-11(16)9-14(21)17-10-13-18-19-15(22)20(13)12-6-7-12/h9,12H,3-8,10H2,1-2H3,(H,17,21)(H,19,22) |
| InChIKey | UJZKIKHJYIUINL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|