C19H26N6O2S — CID 56578117
2-(benzylcarbamoylamino)-N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-methylbutanamide (PubChem CID 56578117) has the molecular formula C19H26N6O2S and a molecular weight of 402.52 g/mol. Its IUPAC name is 2-(benzylcarbamoylamino)-N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-methylbutanamide.
| Compound Name | 2-(benzylcarbamoylamino)-N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 56578117 |
| Molecular Formula | C19H26N6O2S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 2-(benzylcarbamoylamino)-N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-methylbutanamide |
| SMILES | CC(C)C(NC(=O)NCc1ccccc1)C(=O)NCc1n[nH]c(=S)n1C1CC1 |
| InChI | InChI=1S/C19H26N6O2S/c1-12(2)16(22-18(27)21-10-13-6-4-3-5-7-13)17(26)20-11-15-23-24-19(28)25(15)14-8-9-14/h3-7,12,14,16H,8-11H2,1-2H3,(H,20,26)(H,24,28)(H2,21,22,27) |
| InChIKey | NTPAJQNPHRLDRS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|